C21H24N4O2S — CID 58656375
6-(3-ethyl-4-methylanilino)-3-[2-(pyridin-2-ylmethylsulfanyl)ethyl]-1H-pyrimidine-2,4-dione (PubChem CID 58656375) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 6-(3-ethyl-4-methylanilino)-3-[2-(pyridin-2-ylmethylsulfanyl)ethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(3-ethyl-4-methylanilino)-3-[2-(pyridin-2-ylmethylsulfanyl)ethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58656375 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 6-(3-ethyl-4-methylanilino)-3-[2-(pyridin-2-ylmethylsulfanyl)ethyl]-1H-pyrimidine-2,4-dione |
| SMILES | CCc1cc(Nc2cc(=O)n(CCSCc3ccccn3)c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C21H24N4O2S/c1-3-16-12-17(8-7-15(16)2)23-19-13-20(26)25(21(27)24-19)10-11-28-14-18-6-4-5-9-22-18/h4-9,12-13,23H,3,10-11,14H2,1-2H3,(H,24,27) |
| InChIKey | QLVIXNHBFKOITQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|