C22H25N3O5S — CID 58656377
methyl 5-[2-[6-(3-ethyl-4-methylanilino)-2,4-dioxo-1H-pyrimidin-3-yl]ethylsulfanylmethyl]furan-2-carboxylate (PubChem CID 58656377) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is methyl 5-[2-[6-(3-ethyl-4-methylanilino)-2,4-dioxo-1H-pyrimidin-3-yl]ethylsulfanylmethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[2-[6-(3-ethyl-4-methylanilino)-2,4-dioxo-1H-pyrimidin-3-yl]ethylsulfanylmethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 58656377 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | methyl 5-[2-[6-(3-ethyl-4-methylanilino)-2,4-dioxo-1H-pyrimidin-3-yl]ethylsulfanylmethyl]furan-2-carboxylate |
| SMILES | CCc1cc(Nc2cc(=O)n(CCSCc3ccc(C(=O)OC)o3)c(=O)[nH]2)ccc1C |
| InChI | InChI=1S/C22H25N3O5S/c1-4-15-11-16(6-5-14(15)2)23-19-12-20(26)25(22(28)24-19)9-10-31-13-17-7-8-18(30-17)21(27)29-3/h5-8,11-12,23H,4,9-10,13H2,1-3H3,(H,24,28) |
| InChIKey | JIFWAGOTTHUVDO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|