C53H66O8 — CID 58657992
[5'-[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enyl]peroxy-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-yl] (E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 58657992) has the molecular formula C53H66O8 and a molecular weight of 831.10 g/mol. Its IUPAC name is [5'-[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enyl]peroxy-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-yl] (E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [5'-[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enyl]peroxy-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-yl] (E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58657992 |
| Molecular Formula | C53H66O8 |
| Molecular Weight | 831.10 g/mol |
| Exact Mass | 830.48 |
| IUPAC Name | [5'-[(E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enyl]peroxy-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-yl] (E)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCOc1ccc(/C=C/COOc2ccc3c(c2)C2(CC3(C)C)CC(C)(C)c3ccc(OC(=O)/C=C/c4ccc(OCCCCCC)c(OC)c4)cc32)cc1OC |
| InChI | InChI=1S/C53H66O8/c1-9-11-13-15-29-57-46-26-19-38(32-48(46)55-7)18-17-31-59-61-41-23-25-43-45(35-41)53(37-52(43,5)6)36-51(3,4)42-24-22-40(34-44(42)53)60-50(54)28-21-39-20-27-47(49(33-39)56-8)58-30-16-14-12-10-2/h17-28,32-35H,9-16,29-31,36-37H2,1-8H3/b18-17+,28-21+ |
| InChIKey | KZDSAZKMPUAZSB-AJTREZQESA-N |
| XLogP | 12.91 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.10 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|