C25H36O2 — CID 58659696
7,8-dimethyl-5-[(2E)-3,5,7-trimethylocta-2,6-dienyl]spiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol (PubChem CID 58659696) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is 7,8-dimethyl-5-[(2E)-3,5,7-trimethylocta-2,6-dienyl]spiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol.
| Compound Name | 7,8-dimethyl-5-[(2E)-3,5,7-trimethylocta-2,6-dienyl]spiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol |
|---|---|
| PubChem CID | 58659696 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | 7,8-dimethyl-5-[(2E)-3,5,7-trimethylocta-2,6-dienyl]spiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol |
| SMILES | CC(C)=CC(C)C/C(C)=C/Cc1c(O)c(C)c(C)c2c1CCC1(CCC1)O2 |
| InChI | InChI=1S/C25H36O2/c1-16(2)14-18(4)15-17(3)8-9-21-22-10-13-25(11-7-12-25)27-24(22)20(6)19(5)23(21)26/h8,14,18,26H,7,9-13,15H2,1-6H3/b17-8+ |
| InChIKey | CNJHFZBMJDLTNM-CAOOACKPSA-N |
| XLogP | 6.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|