C24H34O2 — CID 69054620
7-(3,7-dimethylocta-2,6-dienyl)-5,8-dimethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol (PubChem CID 69054620) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is 7-(3,7-dimethylocta-2,6-dienyl)-5,8-dimethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol.
| Compound Name | 7-(3,7-dimethylocta-2,6-dienyl)-5,8-dimethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol |
|---|---|
| PubChem CID | 69054620 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 7-(3,7-dimethylocta-2,6-dienyl)-5,8-dimethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol |
| SMILES | CC(C)=CCCC(C)=CCc1c(C)c2c(c(C)c1O)CCC1(CCC1)O2 |
| InChI | InChI=1S/C24H34O2/c1-16(2)8-6-9-17(3)10-11-20-19(5)23-21(18(4)22(20)25)12-15-24(26-23)13-7-14-24/h8,10,25H,6-7,9,11-15H2,1-5H3 |
| InChIKey | YWQMAVGZUDZNOJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|