C34H32N2Pt — CID 58661087
2-(3-tert-butylbenzene-6-id-1-yl)-6-[7-(4-tert-butyl-2-pyridinyl)-8H-naphthalen-8-id-1-yl]pyridine;platinum(2+) (PubChem CID 58661087) has the molecular formula C34H32N2Pt and a molecular weight of 663.72 g/mol. Its IUPAC name is 2-(3-tert-butylbenzene-6-id-1-yl)-6-[7-(4-tert-butyl-2-pyridinyl)-8H-naphthalen-8-id-1-yl]pyridine;platinum(2+).
| Compound Name | 2-(3-tert-butylbenzene-6-id-1-yl)-6-[7-(4-tert-butyl-2-pyridinyl)-8H-naphthalen-8-id-1-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 58661087 |
| Molecular Formula | C34H32N2Pt |
| Molecular Weight | 663.72 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | 2-(3-tert-butylbenzene-6-id-1-yl)-6-[7-(4-tert-butyl-2-pyridinyl)-8H-naphthalen-8-id-1-yl]pyridine;platinum(2+) |
| SMILES | CC(C)(C)c1cc[c-]c(-c2cccc(-c3cccc4ccc(-c5cc(C(C)(C)C)ccn5)[c-]c34)n2)c1.[Pt+2] |
| InChI | InChI=1S/C34H32N2.Pt/c1-33(2,3)26-12-7-11-24(20-26)30-14-9-15-31(36-30)28-13-8-10-23-16-17-25(21-29(23)28)32-22-27(18-19-35-32)34(4,5)6;/h7-10,12-20,22H,1-6H3;/q-2;+2 |
| InChIKey | LAVMOBGFTLMMOP-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.72 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|