C19H17NO5 — CID 58662761
methyl (3E)-3-[(2,6-dimethoxyphenyl)methylidene]-2-oxo-1H-indole-6-carboxylate (PubChem CID 58662761) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is methyl (3E)-3-[(2,6-dimethoxyphenyl)methylidene]-2-oxo-1H-indole-6-carboxylate.
| Compound Name | methyl (3E)-3-[(2,6-dimethoxyphenyl)methylidene]-2-oxo-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 58662761 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | methyl (3E)-3-[(2,6-dimethoxyphenyl)methylidene]-2-oxo-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)NC(=O)/C2=C/c1c(OC)cccc1OC |
| InChI | InChI=1S/C19H17NO5/c1-23-16-5-4-6-17(24-2)14(16)10-13-12-8-7-11(19(22)25-3)9-15(12)20-18(13)21/h4-10H,1-3H3,(H,20,21)/b13-10+ |
| InChIKey | RDIPADXWJKHJFK-JLHYYAGUSA-N |
| XLogP | 2.98 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|