C22H17NO4 — CID 66772507
methyl 3-[4-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 66772507) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl 3-[4-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | methyl 3-[4-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 66772507 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl 3-[4-methyl-5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2cc(C)c(/C=C3\C(=O)Nc4ccccc43)o2)c1 |
| InChI | InChI=1S/C22H17NO4/c1-13-10-20(14-6-5-7-15(11-14)22(25)26-2)27-19(13)12-17-16-8-3-4-9-18(16)23-21(17)24/h3-12H,1-2H3,(H,23,24)/b17-12- |
| InChIKey | CWOMNZUHHHOMFQ-ATVHPVEESA-N |
| XLogP | 4.53 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|