C21H15NO4 — CID 46916911
[5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]methyl benzoate (PubChem CID 46916911) has the molecular formula C21H15NO4 and a molecular weight of 345.35 g/mol. Its IUPAC name is [5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]methyl benzoate.
| Compound Name | [5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 46916911 |
| Molecular Formula | C21H15NO4 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [5-[(Z)-(2-oxo-1H-indol-3-ylidene)methyl]furan-2-yl]methyl benzoate |
| SMILES | O=C1Nc2ccccc2/C1=C/c1ccc(COC(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C21H15NO4/c23-20-18(17-8-4-5-9-19(17)22-20)12-15-10-11-16(26-15)13-25-21(24)14-6-2-1-3-7-14/h1-12H,13H2,(H,22,23)/b18-12- |
| InChIKey | AYOYHEZNBGEBBJ-PDGQHHTCSA-N |
| XLogP | 4.13 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|