C21H19NO7 — CID 73002091
2-[4-ethoxy-3-[(6-methoxycarbonyl-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]acetic acid (PubChem CID 73002091) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is 2-[4-ethoxy-3-[(6-methoxycarbonyl-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-ethoxy-3-[(6-methoxycarbonyl-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 73002091 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[4-ethoxy-3-[(6-methoxycarbonyl-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]acetic acid |
| SMILES | CCOc1ccc(OCC(=O)O)cc1C=C1C(=O)Nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C21H19NO7/c1-3-28-18-7-5-14(29-11-19(23)24)8-13(18)9-16-15-6-4-12(21(26)27-2)10-17(15)22-20(16)25/h4-10H,3,11H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | LMAWLFRTJVXGJV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|