About CID 58663347
CID 58663347 (PubChem CID 58663347) has the molecular formula C12H19F3NO3
and a molecular weight of 282.28 g/mol.
Molecular Properties
| Compound Name | CID 58663347 |
| PubChem CID | 58663347 |
| Molecular Formula | C12H19F3NO3 |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(=O)CC(F)(F)F)CC(C)(C)N1[O] |
| InChI | InChI=1S/C12H19F3NO3/c1-10(2)5-8(6-11(3,4)16(10)18)19-9(17)7-12(13,14)15/h8H,5-7H2,1-4H3 |
| InChIKey | XYUHCBPCPAVAIT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58663347 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58663347?
The IUPAC name of CID 58663347 (CID 58663347) is not available.
What is the SMILES notation for CID 58663347?
The canonical SMILES for CID 58663347 is CC1(C)CC(OC(=O)CC(F)(F)F)CC(C)(C)N1[O].
What is the InChIKey of CID 58663347?
The InChIKey is XYUHCBPCPAVAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F3NO3/c1-10(2)5-8(6-11(3,4)16(10)18)19-9(17)7-12(13,14)15/h8H,5-7H2,1-4H3.
What are the key properties of CID 58663347?
CID 58663347 has a molecular weight of 282.28 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58663347 is sourced from PubChem (CID 58663347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).