About 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile
4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile (PubChem CID 58664735) has the molecular formula C15H11N3O
and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile |
| PubChem CID | 58664735 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile |
| SMILES | Cc1cc(O)cc(-c2cc(C#N)c(C#N)cc2N)c1 |
| InChI | InChI=1S/C15H11N3O/c1-9-2-10(4-13(19)3-9)14-5-11(7-16)12(8-17)6-15(14)18/h2-6,19H,18H2,1H3 |
| InChIKey | JIXZTFQGFOTIOV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile?
The IUPAC name of 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile (CID 58664735) is 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile is Cc1cc(O)cc(-c2cc(C#N)c(C#N)cc2N)c1.
What is the InChIKey of 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile?
The InChIKey is JIXZTFQGFOTIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O/c1-9-2-10(4-13(19)3-9)14-5-11(7-16)12(8-17)6-15(14)18/h2-6,19H,18H2,1H3.
What are the key properties of 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile?
4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile has a molecular weight of 249.27 g/mol, XLogP of 2.69, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-(3-hydroxy-5-methylphenyl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 58664735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).