C46H35N7S — CID 58665969
4-[4-[3-[5-[[(2R)-2-isocyanopyrrolidin-1-yl]methyl]thiophen-2-yl]imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]benzonitrile (PubChem CID 58665969) has the molecular formula C46H35N7S and a molecular weight of 717.90 g/mol. Its IUPAC name is 4-[4-[3-[5-[[(2R)-2-isocyanopyrrolidin-1-yl]methyl]thiophen-2-yl]imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]benzonitrile.
| Compound Name | 4-[4-[3-[5-[[(2R)-2-isocyanopyrrolidin-1-yl]methyl]thiophen-2-yl]imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 58665969 |
| Molecular Formula | C46H35N7S |
| Molecular Weight | 717.90 g/mol |
| Exact Mass | 717.27 |
| IUPAC Name | 4-[4-[3-[5-[[(2R)-2-isocyanopyrrolidin-1-yl]methyl]thiophen-2-yl]imidazo[1,2-a]pyridin-6-yl]-1-tritylpyrazol-3-yl]benzonitrile |
| SMILES | [C-]#[N+][C@@H]1CCCN1Cc1ccc(-c2cnc3ccc(-c4cn(C(c5ccccc5)(c5ccccc5)c5ccccc5)nc4-c4ccc(C#N)cc4)cn23)s1 |
| InChI | InChI=1S/C46H35N7S/c1-48-43-18-11-27-51(43)31-39-24-25-42(54-39)41-29-49-44-26-23-35(30-52(41)44)40-32-53(50-45(40)34-21-19-33(28-47)20-22-34)46(36-12-5-2-6-13-36,37-14-7-3-8-15-37)38-16-9-4-10-17-38/h2-10,12-17,19-26,29-30,32,43H,11,18,27,31H2/t43-/m0/s1 |
| InChIKey | BIGWEKCQMNQTQA-QLKFWGTOSA-N |
| XLogP | 10.15 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.90 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|