C32H58O2Si2 — CID 58666151
tert-butyl-[[1-[2-[5-[tert-butyl(dimethyl)silyl]oxy-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl]ethyl]-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl]oxy]-dimethylsilane (PubChem CID 58666151) has the molecular formula C32H58O2Si2 and a molecular weight of 530.99 g/mol. Its IUPAC name is tert-butyl-[[1-[2-[5-[tert-butyl(dimethyl)silyl]oxy-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl]ethyl]-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[1-[2-[5-[tert-butyl(dimethyl)silyl]oxy-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl]ethyl]-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 58666151 |
| Molecular Formula | C32H58O2Si2 |
| Molecular Weight | 530.99 g/mol |
| Exact Mass | 530.40 |
| IUPAC Name | tert-butyl-[[1-[2-[5-[tert-butyl(dimethyl)silyl]oxy-3a,4,5,6,7,7a-hexahydro-3H-inden-1-yl]ethyl]-3a,4,5,6,7,7a-hexahydro-3H-inden-5-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC2C(CCC3=CCC4CC(O[Si](C)(C)C(C)(C)C)CCC34)=CCC2C1 |
| InChI | InChI=1S/C32H58O2Si2/c1-31(2,3)35(7,8)33-27-17-19-29-23(13-15-25(29)21-27)11-12-24-14-16-26-22-28(18-20-30(24)26)34-36(9,10)32(4,5)6/h13-14,25-30H,11-12,15-22H2,1-10H3 |
| InChIKey | NDCMKUBOHYSOSC-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.99 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|