C14H28N4OSi — CID 67010143
N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2H-triazol-4-amine (PubChem CID 67010143) has the molecular formula C14H28N4OSi and a molecular weight of 296.49 g/mol. Its IUPAC name is N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2H-triazol-4-amine.
| Compound Name | N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2H-triazol-4-amine |
|---|---|
| PubChem CID | 67010143 |
| Molecular Formula | C14H28N4OSi |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N-[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-2H-triazol-4-amine |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(Nc2cn[nH]n2)CC1 |
| InChI | InChI=1S/C14H28N4OSi/c1-14(2,3)20(4,5)19-12-8-6-11(7-9-12)16-13-10-15-18-17-13/h10-12H,6-9H2,1-5H3,(H2,15,16,17,18) |
| InChIKey | ROXGBUIHFSITFG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|