C11H11ClN4O — CID 586663
N-[2-(4-chlorophenyl)ethyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 586663) has the molecular formula C11H11ClN4O and a molecular weight of 250.69 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 586663 |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C11H11ClN4O/c12-9-3-1-8(2-4-9)5-6-13-11(17)10-14-7-15-16-10/h1-4,7H,5-6H2,(H,13,17)(H,14,15,16) |
| InChIKey | YKGHTVVZVCJRDQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |