About N-benzyl-1H-1,2,4-triazole-5-carboxamide
N-benzyl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 1072357) has the molecular formula C10H10N4O
and a molecular weight of 202.22 g/mol. Its IUPAC name is N-benzyl-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | N-benzyl-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 1072357 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | N-benzyl-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H10N4O/c15-10(9-12-7-13-14-9)11-6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,11,15)(H,12,13,14) |
| InChIKey | RMWPCPKYWQJAHT-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of N-benzyl-1H-1,2,4-triazole-5-carboxamide (CID 1072357) is N-benzyl-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for N-benzyl-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for N-benzyl-1H-1,2,4-triazole-5-carboxamide is O=C(NCc1ccccc1)c1ncn[nH]1.
What is the InChIKey of N-benzyl-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is RMWPCPKYWQJAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O/c15-10(9-12-7-13-14-9)11-6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,11,15)(H,12,13,14).
What are the key properties of N-benzyl-1H-1,2,4-triazole-5-carboxamide?
N-benzyl-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 202.22 g/mol, XLogP of 0.73, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 1072357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).