C10H9ClN4O — CID 2976151
N-[(4-chlorophenyl)methyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 2976151) has the molecular formula C10H9ClN4O and a molecular weight of 236.66 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 2976151 |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ncn[nH]1 |
| InChI | InChI=1S/C10H9ClN4O/c11-8-3-1-7(2-4-8)5-12-10(16)9-13-6-14-15-9/h1-4,6H,5H2,(H,12,16)(H,13,14,15) |
| InChIKey | VKXAVGLOVYSXOH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |