C15H21BN4O3 — CID 155563323
[(1R)-1-[(1-benzyl-1,2,4-triazole-3-carbonyl)amino]-3-methylbutyl]boronic acid (PubChem CID 155563323) has the molecular formula C15H21BN4O3 and a molecular weight of 316.17 g/mol. Its IUPAC name is [(1R)-1-[(1-benzyl-1,2,4-triazole-3-carbonyl)amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[(1-benzyl-1,2,4-triazole-3-carbonyl)amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 155563323 |
| Molecular Formula | C15H21BN4O3 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(1R)-1-[(1-benzyl-1,2,4-triazole-3-carbonyl)amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1ncn(Cc2ccccc2)n1)B(O)O |
| InChI | InChI=1S/C15H21BN4O3/c1-11(2)8-13(16(22)23)18-15(21)14-17-10-20(19-14)9-12-6-4-3-5-7-12/h3-7,10-11,13,22-23H,8-9H2,1-2H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | RDAFLCPQRVOUNX-ZDUSSCGKSA-N |
| XLogP | 0.48 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|