About N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium)
N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium) (PubChem CID 58667078) has the molecular formula C18H22N2Y2-2
and a molecular weight of 444.20 g/mol. Its IUPAC name is N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium).
Molecular Properties
| Compound Name | N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium) |
| PubChem CID | 58667078 |
| Molecular Formula | C18H22N2Y2-2 |
| Molecular Weight | 444.20 g/mol |
| Exact Mass | 443.99 |
| IUPAC Name | N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium) |
| SMILES | CC(NCCNC(C)c1[c-]cccc1)c1[c-]cccc1.[Y].[Y] |
| InChI | InChI=1S/C18H22N2.2Y/c1-15(17-9-5-3-6-10-17)19-13-14-20-16(2)18-11-7-4-8-12-18;;/h3-9,11,15-16,19-20H,13-14H2,1-2H3;;/q-2;; |
| InChIKey | XQJGGKIOZXUMEO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium)?
The IUPAC name of N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium) (CID 58667078) is N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium).
What is the SMILES notation for N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium)?
The canonical SMILES for N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium) is CC(NCCNC(C)c1[c-]cccc1)c1[c-]cccc1.[Y].[Y].
What is the InChIKey of N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium)?
The InChIKey is XQJGGKIOZXUMEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2.2Y/c1-15(17-9-5-3-6-10-17)19-13-14-20-16(2)18-11-7-4-8-12-18;;/h3-9,11,15-16,19-20H,13-14H2,1-2H3;;/q-2;;.
What are the key properties of N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium)?
N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium) has a molecular weight of 444.20 g/mol, XLogP of 3.28, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(1-phenylethyl)ethane-1,2-diamine;bis(yttrium) is sourced from PubChem (CID 58667078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).