C26H18N2O4 — CID 58667412
4-[7-[4-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]benzoic acid (PubChem CID 58667412) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is 4-[7-[4-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]benzoic acid.
| Compound Name | 4-[7-[4-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 58667412 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 4-[7-[4-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccnc3c2ccc2c(-c4ccc(OCO)cc4)ccnc23)cc1 |
| InChI | InChI=1S/C26H18N2O4/c29-15-32-19-7-5-17(6-8-19)21-12-14-28-25-23(21)10-9-22-20(11-13-27-24(22)25)16-1-3-18(4-2-16)26(30)31/h1-14,29H,15H2,(H,30,31) |
| InChIKey | SFOWAQJPZORJMY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|