C36H27EuF3N2O10S — CID 58667420
4-[7-[4-carboxy-3-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]phthalic acid;europium;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol (PubChem CID 58667420) has the molecular formula C36H27EuF3N2O10S and a molecular weight of 888.64 g/mol. Its IUPAC name is 4-[7-[4-carboxy-3-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]phthalic acid;europium;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol.
| Compound Name | 4-[7-[4-carboxy-3-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]phthalic acid;europium;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol |
|---|---|
| PubChem CID | 58667420 |
| Molecular Formula | C36H27EuF3N2O10S |
| Molecular Weight | 888.64 g/mol |
| Exact Mass | 889.06 |
| IUPAC Name | 4-[7-[4-carboxy-3-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]phthalic acid;europium;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol |
| SMILES | O=C(O)c1ccc(-c2ccnc3c2ccc2c(-c4ccc(C(=O)O)c(C(=O)O)c4)ccnc23)cc1OCO.OC(CC(O)C(F)(F)F)c1cccs1.[Eu] |
| InChI | InChI=1S/C28H18N2O8.C8H9F3O2S.Eu/c31-13-38-23-12-15(2-4-21(23)27(34)35)17-8-10-30-25-19(17)6-5-18-16(7-9-29-24(18)25)14-1-3-20(26(32)33)22(11-14)28(36)37;9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-12,31H,13H2,(H,32,33)(H,34,35)(H,36,37);1-3,5,7,12-13H,4H2; |
| InChIKey | HQZSAUAOIMHZAS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 207.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|