C34H27EuF3N2O6S — CID 58667411
europium;4-[7-[4-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]benzoic acid;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol (PubChem CID 58667411) has the molecular formula C34H27EuF3N2O6S and a molecular weight of 800.62 g/mol. Its IUPAC name is europium;4-[7-[4-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]benzoic acid;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol.
| Compound Name | europium;4-[7-[4-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]benzoic acid;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol |
|---|---|
| PubChem CID | 58667411 |
| Molecular Formula | C34H27EuF3N2O6S |
| Molecular Weight | 800.62 g/mol |
| Exact Mass | 801.08 |
| IUPAC Name | europium;4-[7-[4-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]benzoic acid;4,4,4-trifluoro-1-thiophen-2-ylbutane-1,3-diol |
| SMILES | O=C(O)c1ccc(-c2ccnc3c2ccc2c(-c4ccc(OCO)cc4)ccnc23)cc1.OC(CC(O)C(F)(F)F)c1cccs1.[Eu] |
| InChI | InChI=1S/C26H18N2O4.C8H9F3O2S.Eu/c29-15-32-19-7-5-17(6-8-19)21-12-14-28-25-23(21)10-9-22-20(11-13-27-24(22)25)16-1-3-18(4-2-16)26(30)31;9-8(10,11)7(13)4-5(12)6-2-1-3-14-6;/h1-14,29H,15H2,(H,30,31);1-3,5,7,12-13H,4H2; |
| InChIKey | SETHJRKCGRMPSV-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 133.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.62 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|