C32H26EuN2O2S — CID 59641506
europium;(2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone;4-methyl-7-phenyl-1,10-phenanthroline (PubChem CID 59641506) has the molecular formula C32H26EuN2O2S and a molecular weight of 654.60 g/mol. Its IUPAC name is europium;(2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone;4-methyl-7-phenyl-1,10-phenanthroline.
| Compound Name | europium;(2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone;4-methyl-7-phenyl-1,10-phenanthroline |
|---|---|
| PubChem CID | 59641506 |
| Molecular Formula | C32H26EuN2O2S |
| Molecular Weight | 654.60 g/mol |
| Exact Mass | 655.09 |
| IUPAC Name | europium;(2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone;4-methyl-7-phenyl-1,10-phenanthroline |
| SMILES | Cc1cc(C)c(O)c(C(=O)c2cccs2)c1.Cc1ccnc2c1ccc1c(-c3ccccc3)ccnc12.[Eu] |
| InChI | InChI=1S/C19H14N2.C13H12O2S.Eu/c1-13-9-11-20-18-15(13)7-8-17-16(10-12-21-19(17)18)14-5-3-2-4-6-14;1-8-6-9(2)12(14)10(7-8)13(15)11-4-3-5-16-11;/h2-12H,1H3;3-7,14H,1-2H3; |
| InChIKey | VNGKMQOFPVLKSV-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.60 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|