C28H18N2O8 — CID 58667421
4-[7-[4-carboxy-3-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]phthalic acid (PubChem CID 58667421) has the molecular formula C28H18N2O8 and a molecular weight of 510.46 g/mol. Its IUPAC name is 4-[7-[4-carboxy-3-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]phthalic acid.
| Compound Name | 4-[7-[4-carboxy-3-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]phthalic acid |
|---|---|
| PubChem CID | 58667421 |
| Molecular Formula | C28H18N2O8 |
| Molecular Weight | 510.46 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 4-[7-[4-carboxy-3-(hydroxymethoxy)phenyl]-1,10-phenanthrolin-4-yl]phthalic acid |
| SMILES | O=C(O)c1ccc(-c2ccnc3c2ccc2c(-c4ccc(C(=O)O)c(C(=O)O)c4)ccnc23)cc1OCO |
| InChI | InChI=1S/C28H18N2O8/c31-13-38-23-12-15(2-4-21(23)27(34)35)17-8-10-30-25-19(17)6-5-18-16(7-9-29-24(18)25)14-1-3-20(26(32)33)22(11-14)28(36)37/h1-12,31H,13H2,(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | PGTOZLRVPVPLKV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 167.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|