C13H19N2O5P — CID 58672729
5-[(E)-but-1-enyl]-1-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 58672729) has the molecular formula C13H19N2O5P and a molecular weight of 316.29 g/mol. Its IUPAC name is 5-[(E)-but-1-enyl]-1-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[(E)-but-1-enyl]-1-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58672729 |
| Molecular Formula | C13H19N2O5P |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 5-[(E)-but-1-enyl]-1-[4-hydroxy-5-(tritiophosphanyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [3H]POCC1OC(n2cc(/C=C/CC)c(=O)[nH]c2=O)CC1O |
| InChI | InChI=1S/C13H19N2O5P/c1-2-3-4-8-6-15(13(18)14-12(8)17)11-5-9(16)10(20-11)7-19-21/h3-4,6,9-11,16H,2,5,7,21H2,1H3,(H,14,17,18)/b4-3+/i21T |
| InChIKey | AQYZVJPNNINVOT-AXAIEFMDSA-N |
| XLogP | 0.41 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|