C22H36O — CID 58673026
1-[(2R,3E,5E)-7-ethyl-7-methylnona-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 58673026) has the molecular formula C22H36O and a molecular weight of 316.53 g/mol. Its IUPAC name is 1-[(2R,3E,5E)-7-ethyl-7-methylnona-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | 1-[(2R,3E,5E)-7-ethyl-7-methylnona-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 58673026 |
| Molecular Formula | C22H36O |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | 1-[(2R,3E,5E)-7-ethyl-7-methylnona-3,5-dien-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CCC(C)(/C=C/C=C/[C@@H](C)C1CCC2C(=O)CCCC21C)CC |
| InChI | InChI=1S/C22H36O/c1-6-21(4,7-2)15-9-8-11-17(3)18-13-14-19-20(23)12-10-16-22(18,19)5/h8-9,11,15,17-19H,6-7,10,12-14,16H2,1-5H3/b11-8+,15-9+/t17-,18?,19?,22?/m1/s1 |
| InChIKey | WXPDFFPZIAOWJC-NDTZVCRCSA-N |
| XLogP | 6.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|