C26H40O2Si — CID 70303794
(1R,3aR,7aR)-7a-methyl-1-[(E,2R)-4-[4-(2-trimethylsilyloxypropan-2-yl)phenyl]but-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 70303794) has the molecular formula C26H40O2Si and a molecular weight of 412.69 g/mol. Its IUPAC name is (1R,3aR,7aR)-7a-methyl-1-[(E,2R)-4-[4-(2-trimethylsilyloxypropan-2-yl)phenyl]but-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-7a-methyl-1-[(E,2R)-4-[4-(2-trimethylsilyloxypropan-2-yl)phenyl]but-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 70303794 |
| Molecular Formula | C26H40O2Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (1R,3aR,7aR)-7a-methyl-1-[(E,2R)-4-[4-(2-trimethylsilyloxypropan-2-yl)phenyl]but-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C[C@H](/C=C/c1ccc(C(C)(C)O[Si](C)(C)C)cc1)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C26H40O2Si/c1-19(22-16-17-23-24(27)9-8-18-26(22,23)4)10-11-20-12-14-21(15-13-20)25(2,3)28-29(5,6)7/h10-15,19,22-23H,8-9,16-18H2,1-7H3/b11-10+/t19-,22-,23+,26-/m1/s1 |
| InChIKey | WKOJQJVMOYMNPU-VIGMRXMGSA-N |
| XLogP | 7.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|