C25H36O2 — CID 146959621
(1R,3aR,7aR)-7a-methyl-1-[(E,2R,5S)-6-methyl-5-phenylmethoxyhept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 146959621) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (1R,3aR,7aR)-7a-methyl-1-[(E,2R,5S)-6-methyl-5-phenylmethoxyhept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-7a-methyl-1-[(E,2R,5S)-6-methyl-5-phenylmethoxyhept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 146959621 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (1R,3aR,7aR)-7a-methyl-1-[(E,2R,5S)-6-methyl-5-phenylmethoxyhept-3-en-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CC(C)[C@@H](/C=C/[C@@H](C)[C@H]1CC[C@H]2C(=O)CCC[C@]12C)OCc1ccccc1 |
| InChI | InChI=1S/C25H36O2/c1-18(2)24(27-17-20-9-6-5-7-10-20)15-12-19(3)21-13-14-22-23(26)11-8-16-25(21,22)4/h5-7,9-10,12,15,18-19,21-22,24H,8,11,13-14,16-17H2,1-4H3/b15-12+/t19-,21-,22+,24-,25-/m1/s1 |
| InChIKey | AKIDOXXSFPKWIF-SYFIDZORSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|