C19H26O3S — CID 124563609
(1S,3aR,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 124563609) has the molecular formula C19H26O3S and a molecular weight of 334.48 g/mol. Its IUPAC name is (1S,3aR,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1S,3aR,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 124563609 |
| Molecular Formula | C19H26O3S |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | (1S,3aR,7aR)-1-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@@H]1CC[C@H]2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C19H26O3S/c1-14(13-23(21,22)15-7-4-3-5-8-15)16-10-11-17-18(20)9-6-12-19(16,17)2/h3-5,7-8,14,16-17H,6,9-13H2,1-2H3/t14-,16+,17+,19-/m1/s1 |
| InChIKey | NOTLMIUEVPUTDY-QSOKESPWSA-N |
| XLogP | 3.88 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |