C26H40O2Si — CID 56974650
(1R,7aR)-1-[(2R)-4-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]but-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 56974650) has the molecular formula C26H40O2Si and a molecular weight of 412.69 g/mol. Its IUPAC name is (1R,7aR)-1-[(2R)-4-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]but-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,7aR)-1-[(2R)-4-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]but-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 56974650 |
| Molecular Formula | C26H40O2Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | (1R,7aR)-1-[(2R)-4-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]but-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C[C@H](C=Cc1cccc(O[Si](C)(C)C(C)(C)C)c1)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C26H40O2Si/c1-19(22-15-16-23-24(27)12-9-17-26(22,23)5)13-14-20-10-8-11-21(18-20)28-29(6,7)25(2,3)4/h8,10-11,13-14,18-19,22-23H,9,12,15-17H2,1-7H3/t19-,22-,23?,26-/m1/s1 |
| InChIKey | LGPPXIFIXCTMFB-DDQWDELTSA-N |
| XLogP | 7.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|