C23H32O3 — CID 70303653
ethyl 3-[3-[(1R,3aR,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]but-1-enyl]benzoate (PubChem CID 70303653) has the molecular formula C23H32O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is ethyl 3-[3-[(1R,3aR,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]but-1-enyl]benzoate.
| Compound Name | ethyl 3-[3-[(1R,3aR,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]but-1-enyl]benzoate |
|---|---|
| PubChem CID | 70303653 |
| Molecular Formula | C23H32O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | ethyl 3-[3-[(1R,3aR,4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]but-1-enyl]benzoate |
| SMILES | CCOC(=O)c1cccc(C=CC(C)[C@H]2CC[C@H]3[C@@H](O)CCC[C@]23C)c1 |
| InChI | InChI=1S/C23H32O3/c1-4-26-22(25)18-8-5-7-17(15-18)11-10-16(2)19-12-13-20-21(24)9-6-14-23(19,20)3/h5,7-8,10-11,15-16,19-21,24H,4,6,9,12-14H2,1-3H3/t16?,19-,20+,21+,23-/m1/s1 |
| InChIKey | QDRWFBPTCQZZJI-MMXMZEROSA-N |
| XLogP | 5.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |