C20H36O3 — CID 58446634
ethyl (5R)-5-[(4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4,4-dimethylhexanoate (PubChem CID 58446634) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is ethyl (5R)-5-[(4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4,4-dimethylhexanoate.
| Compound Name | ethyl (5R)-5-[(4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4,4-dimethylhexanoate |
|---|---|
| PubChem CID | 58446634 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | ethyl (5R)-5-[(4S,7aR)-4-hydroxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-4,4-dimethylhexanoate |
| SMILES | CCOC(=O)CCC(C)(C)[C@H](C)C1CCC2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C20H36O3/c1-6-23-18(22)11-13-19(3,4)14(2)15-9-10-16-17(21)8-7-12-20(15,16)5/h14-17,21H,6-13H2,1-5H3/t14-,15?,16?,17+,20-/m1/s1 |
| InChIKey | LRVFEOPYJOHPBE-RKROSOFCSA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |