C24H44O3Si — CID 67681989
(1R,3aR,7aR)-1-[(E)-5-(2-ethyl-2-trimethylsilyloxybutoxy)pent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 67681989) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-[(E)-5-(2-ethyl-2-trimethylsilyloxybutoxy)pent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-1-[(E)-5-(2-ethyl-2-trimethylsilyloxybutoxy)pent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 67681989 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | (1R,3aR,7aR)-1-[(E)-5-(2-ethyl-2-trimethylsilyloxybutoxy)pent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | CCC(CC)(COC/C=C/C(C)[C@H]1CC[C@H]2C(=O)CCC[C@]12C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H44O3Si/c1-8-24(9-2,27-28(5,6)7)18-26-17-11-12-19(3)20-14-15-21-22(25)13-10-16-23(20,21)4/h11-12,19-21H,8-10,13-18H2,1-7H3/b12-11+/t19?,20-,21+,23-/m1/s1 |
| InChIKey | SRHIQUHBMWRYGI-QNWKBZDASA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|