C22H40O3Si — CID 102429028
(1R,3aR,7aR)-7a-methyl-1-[(1S)-1-[(2S,5S)-5-(2-trimethylsilyloxypropan-2-yl)oxolan-2-yl]ethyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 102429028) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is (1R,3aR,7aR)-7a-methyl-1-[(1S)-1-[(2S,5S)-5-(2-trimethylsilyloxypropan-2-yl)oxolan-2-yl]ethyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-7a-methyl-1-[(1S)-1-[(2S,5S)-5-(2-trimethylsilyloxypropan-2-yl)oxolan-2-yl]ethyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 102429028 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | (1R,3aR,7aR)-7a-methyl-1-[(1S)-1-[(2S,5S)-5-(2-trimethylsilyloxypropan-2-yl)oxolan-2-yl]ethyl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C[C@H]([C@@H]1CC[C@@H](C(C)(C)O[Si](C)(C)C)O1)[C@H]1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C22H40O3Si/c1-15(16-10-11-17-18(23)9-8-14-22(16,17)4)19-12-13-20(24-19)21(2,3)25-26(5,6)7/h15-17,19-20H,8-14H2,1-7H3/t15-,16+,17-,19-,20-,22+/m0/s1 |
| InChIKey | OSLQWVUIILREGR-OJFSWGMXSA-N |
| XLogP | 5.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|