C17H10F6IrN3O3S- — CID 58675853
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pyrimidine-2-sulfonic acid (PubChem CID 58675853) has the molecular formula C17H10F6IrN3O3S- and a molecular weight of 642.56 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pyrimidine-2-sulfonic acid.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pyrimidine-2-sulfonic acid |
|---|---|
| PubChem CID | 58675853 |
| Molecular Formula | C17H10F6IrN3O3S- |
| Molecular Weight | 642.56 g/mol |
| Exact Mass | 643.00 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pyrimidine-2-sulfonic acid |
| SMILES | FC(F)(F)c1[c-]c(-c2ccccn2)cc(C(F)(F)F)c1.O=S(=O)(O)c1ncccn1.[Ir] |
| InChI | InChI=1S/C13H6F6N.C4H4N2O3S.Ir/c14-12(15,16)9-5-8(11-3-1-2-4-20-11)6-10(7-9)13(17,18)19;7-10(8,9)4-5-2-1-3-6-4;/h1-5,7H;1-3H,(H,7,8,9);/q-1;; |
| InChIKey | OWOUGUYQBXDIHT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|