C20H17F6IrN4O3S- — CID 58675929
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;6-(dimethylamino)-2-methylpyrimidine-4-sulfonic acid;iridium (PubChem CID 58675929) has the molecular formula C20H17F6IrN4O3S- and a molecular weight of 699.65 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;6-(dimethylamino)-2-methylpyrimidine-4-sulfonic acid;iridium.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;6-(dimethylamino)-2-methylpyrimidine-4-sulfonic acid;iridium |
|---|---|
| PubChem CID | 58675929 |
| Molecular Formula | C20H17F6IrN4O3S- |
| Molecular Weight | 699.65 g/mol |
| Exact Mass | 700.06 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;6-(dimethylamino)-2-methylpyrimidine-4-sulfonic acid;iridium |
| SMILES | Cc1nc(N(C)C)cc(S(=O)(=O)O)n1.FC(F)(F)c1[c-]c(-c2ccccn2)cc(C(F)(F)F)c1.[Ir] |
| InChI | InChI=1S/C13H6F6N.C7H11N3O3S.Ir/c14-12(15,16)9-5-8(11-3-1-2-4-20-11)6-10(7-9)13(17,18)19;1-5-8-6(10(2)3)4-7(9-5)14(11,12)13;/h1-5,7H;4H,1-3H3,(H,11,12,13);/q-1;; |
| InChIKey | ZVYQELNUIIBJGN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.65 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|