C18H11F6IrN2O3S- — CID 58675919
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pyridine-2-sulfonic acid (PubChem CID 58675919) has the molecular formula C18H11F6IrN2O3S- and a molecular weight of 641.57 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pyridine-2-sulfonic acid.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 58675919 |
| Molecular Formula | C18H11F6IrN2O3S- |
| Molecular Weight | 641.57 g/mol |
| Exact Mass | 642.00 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;pyridine-2-sulfonic acid |
| SMILES | FC(F)(F)c1[c-]c(-c2ccccn2)cc(C(F)(F)F)c1.O=S(=O)(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C13H6F6N.C5H5NO3S.Ir/c14-12(15,16)9-5-8(11-3-1-2-4-20-11)6-10(7-9)13(17,18)19;7-10(8,9)5-3-1-2-4-6-5;/h1-5,7H;1-4H,(H,7,8,9);/q-1;; |
| InChIKey | NEAQMQBXIQXQMZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|