C17H12F3IrN2O3S- — CID 58675858
iridium;2-phenylpyridine;5-(trifluoromethyl)pyridine-2-sulfonic acid (PubChem CID 58675858) has the molecular formula C17H12F3IrN2O3S- and a molecular weight of 573.57 g/mol. Its IUPAC name is iridium;2-phenylpyridine;5-(trifluoromethyl)pyridine-2-sulfonic acid.
| Compound Name | iridium;2-phenylpyridine;5-(trifluoromethyl)pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 58675858 |
| Molecular Formula | C17H12F3IrN2O3S- |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 574.02 |
| IUPAC Name | iridium;2-phenylpyridine;5-(trifluoromethyl)pyridine-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(C(F)(F)F)cn1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.C6H4F3NO3S.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;7-6(8,9)4-1-2-5(10-3-4)14(11,12)13;/h1-6,8-9H;1-3H,(H,11,12,13);/q-1;; |
| InChIKey | WTBFIMHNBIPGCX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|