C20H18F3IrN2O5S2- — CID 58675885
iridium;4-propan-2-yl-2-[3-(trifluoromethylperoxysulfanyl)benzene-6-id-1-yl]pyridine;pyridine-2-sulfonic acid (PubChem CID 58675885) has the molecular formula C20H18F3IrN2O5S2- and a molecular weight of 679.72 g/mol. Its IUPAC name is iridium;4-propan-2-yl-2-[3-(trifluoromethylperoxysulfanyl)benzene-6-id-1-yl]pyridine;pyridine-2-sulfonic acid.
| Compound Name | iridium;4-propan-2-yl-2-[3-(trifluoromethylperoxysulfanyl)benzene-6-id-1-yl]pyridine;pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 58675885 |
| Molecular Formula | C20H18F3IrN2O5S2- |
| Molecular Weight | 679.72 g/mol |
| Exact Mass | 680.02 |
| IUPAC Name | iridium;4-propan-2-yl-2-[3-(trifluoromethylperoxysulfanyl)benzene-6-id-1-yl]pyridine;pyridine-2-sulfonic acid |
| SMILES | CC(C)c1ccnc(-c2[c-]ccc(SOOC(F)(F)F)c2)c1.O=S(=O)(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C15H13F3NO2S.C5H5NO3S.Ir/c1-10(2)11-6-7-19-14(9-11)12-4-3-5-13(8-12)22-21-20-15(16,17)18;7-10(8,9)5-3-1-2-4-6-5;/h3,5-10H,1-2H3;1-4H,(H,7,8,9);/q-1;; |
| InChIKey | OALKLADTKDHVTM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|