C21H17F6IrN2O3S- — CID 58675913
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-propan-2-ylpyridine;iridium;pyridine-2-sulfonic acid (PubChem CID 58675913) has the molecular formula C21H17F6IrN2O3S- and a molecular weight of 683.65 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-propan-2-ylpyridine;iridium;pyridine-2-sulfonic acid.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-propan-2-ylpyridine;iridium;pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 58675913 |
| Molecular Formula | C21H17F6IrN2O3S- |
| Molecular Weight | 683.65 g/mol |
| Exact Mass | 684.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]-4-propan-2-ylpyridine;iridium;pyridine-2-sulfonic acid |
| SMILES | CC(C)c1ccnc(-c2[c-]c(C(F)(F)F)cc(C(F)(F)F)c2)c1.O=S(=O)(O)c1ccccn1.[Ir] |
| InChI | InChI=1S/C16H12F6N.C5H5NO3S.Ir/c1-9(2)10-3-4-23-14(7-10)11-5-12(15(17,18)19)8-13(6-11)16(20,21)22;7-10(8,9)5-3-1-2-4-6-5;/h3-5,7-9H,1-2H3;1-4H,(H,7,8,9);/q-1;; |
| InChIKey | JZRIMLHHIACRHU-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|