C17H12F3IrN2O4S- — CID 58675830
iridium;2-phenylpyridine;4-(trifluoromethoxy)pyridine-2-sulfonic acid (PubChem CID 58675830) has the molecular formula C17H12F3IrN2O4S- and a molecular weight of 589.57 g/mol. Its IUPAC name is iridium;2-phenylpyridine;4-(trifluoromethoxy)pyridine-2-sulfonic acid.
| Compound Name | iridium;2-phenylpyridine;4-(trifluoromethoxy)pyridine-2-sulfonic acid |
|---|---|
| PubChem CID | 58675830 |
| Molecular Formula | C17H12F3IrN2O4S- |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 590.01 |
| IUPAC Name | iridium;2-phenylpyridine;4-(trifluoromethoxy)pyridine-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc(OC(F)(F)F)ccn1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.C6H4F3NO4S.Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;7-6(8,9)14-4-1-2-10-5(3-4)15(11,12)13;/h1-6,8-9H;1-3H,(H,11,12,13);/q-1;; |
| InChIKey | SCAMGGXEOFWEOP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|