C17H9F7IrN3O5S- — CID 58675869
2-[2-fluoro-4-(trifluoromethoxy)benzene-6-id-1-yl]pyridine;iridium;6-(trifluoromethoxy)pyrimidine-4-sulfonic acid (PubChem CID 58675869) has the molecular formula C17H9F7IrN3O5S- and a molecular weight of 692.54 g/mol. Its IUPAC name is 2-[2-fluoro-4-(trifluoromethoxy)benzene-6-id-1-yl]pyridine;iridium;6-(trifluoromethoxy)pyrimidine-4-sulfonic acid.
| Compound Name | 2-[2-fluoro-4-(trifluoromethoxy)benzene-6-id-1-yl]pyridine;iridium;6-(trifluoromethoxy)pyrimidine-4-sulfonic acid |
|---|---|
| PubChem CID | 58675869 |
| Molecular Formula | C17H9F7IrN3O5S- |
| Molecular Weight | 692.54 g/mol |
| Exact Mass | 692.98 |
| IUPAC Name | 2-[2-fluoro-4-(trifluoromethoxy)benzene-6-id-1-yl]pyridine;iridium;6-(trifluoromethoxy)pyrimidine-4-sulfonic acid |
| SMILES | Fc1cc(OC(F)(F)F)c[c-]c1-c1ccccn1.O=S(=O)(O)c1cc(OC(F)(F)F)ncn1.[Ir] |
| InChI | InChI=1S/C12H6F4NO.C5H3F3N2O4S.Ir/c13-10-7-8(18-12(14,15)16)4-5-9(10)11-3-1-2-6-17-11;6-5(7,8)14-3-1-4(10-2-9-3)15(11,12)13;/h1-4,6-7H;1-2H,(H,11,12,13);/q-1;; |
| InChIKey | IKWWAFYIZHWLBU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|