C11H23N2+ — CID 58677836
3-methyl-1,4-di(propan-2-yl)-3,5-dihydro-2H-pyrazin-1-ium (PubChem CID 58677836) has the molecular formula C11H23N2+ and a molecular weight of 183.32 g/mol. Its IUPAC name is 3-methyl-1,4-di(propan-2-yl)-3,5-dihydro-2H-pyrazin-1-ium.
| Compound Name | 3-methyl-1,4-di(propan-2-yl)-3,5-dihydro-2H-pyrazin-1-ium |
|---|---|
| PubChem CID | 58677836 |
| Molecular Formula | C11H23N2+ |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.19 |
| IUPAC Name | 3-methyl-1,4-di(propan-2-yl)-3,5-dihydro-2H-pyrazin-1-ium |
| SMILES | CC(C)N1CC=[N+](C(C)C)CC1C |
| InChI | InChI=1S/C11H23N2/c1-9(2)12-6-7-13(10(3)4)11(5)8-12/h6,9-11H,7-8H2,1-5H3/q+1 |
| InChIKey | AKLZOGFUBSWODS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|