C17H20N3O3+ — CID 58679918
benzyl N-[(2S)-1-amino-3-(1-methylpyridin-1-ium-3-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 58679918) has the molecular formula C17H20N3O3+ and a molecular weight of 314.37 g/mol. Its IUPAC name is benzyl N-[(2S)-1-amino-3-(1-methylpyridin-1-ium-3-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-amino-3-(1-methylpyridin-1-ium-3-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 58679918 |
| Molecular Formula | C17H20N3O3+ |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | benzyl N-[(2S)-1-amino-3-(1-methylpyridin-1-ium-3-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | C[n+]1cccc(C[C@H](NC(=O)OCc2ccccc2)C(N)=O)c1 |
| InChI | InChI=1S/C17H19N3O3/c1-20-9-5-8-14(11-20)10-15(16(18)21)19-17(22)23-12-13-6-3-2-4-7-13/h2-9,11,15H,10,12H2,1H3,(H2-,18,19,21,22)/p+1/t15-/m0/s1 |
| InChIKey | PPRCCDSJXNARGG-HNNXBMFYSA-O |
| XLogP | 0.83 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|