C6H10F3NOS — CID 58684557
2-(3,4,4-trifluorobut-3-enylsulfinyl)ethanamine (PubChem CID 58684557) has the molecular formula C6H10F3NOS and a molecular weight of 201.21 g/mol. Its IUPAC name is 2-(3,4,4-trifluorobut-3-enylsulfinyl)ethanamine.
| Compound Name | 2-(3,4,4-trifluorobut-3-enylsulfinyl)ethanamine |
|---|---|
| PubChem CID | 58684557 |
| Molecular Formula | C6H10F3NOS |
| Molecular Weight | 201.21 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-(3,4,4-trifluorobut-3-enylsulfinyl)ethanamine |
| SMILES | NCCS(=O)CCC(F)=C(F)F |
| InChI | InChI=1S/C6H10F3NOS/c7-5(6(8)9)1-3-12(11)4-2-10/h1-4,10H2 |
| InChIKey | CLHACGSGISWNSV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |