C20H22Cl2N2O5S — CID 58685788
N-[2-[4-(2,4-dichlorophenoxy)piperidin-1-yl]sulfonyl-1-phenylethyl]-N-hydroxyformamide (PubChem CID 58685788) has the molecular formula C20H22Cl2N2O5S and a molecular weight of 473.38 g/mol. Its IUPAC name is N-[2-[4-(2,4-dichlorophenoxy)piperidin-1-yl]sulfonyl-1-phenylethyl]-N-hydroxyformamide.
| Compound Name | N-[2-[4-(2,4-dichlorophenoxy)piperidin-1-yl]sulfonyl-1-phenylethyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 58685788 |
| Molecular Formula | C20H22Cl2N2O5S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | N-[2-[4-(2,4-dichlorophenoxy)piperidin-1-yl]sulfonyl-1-phenylethyl]-N-hydroxyformamide |
| SMILES | O=CN(O)C(CS(=O)(=O)N1CCC(Oc2ccc(Cl)cc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H22Cl2N2O5S/c21-16-6-7-20(18(22)12-16)29-17-8-10-23(11-9-17)30(27,28)13-19(24(26)14-25)15-4-2-1-3-5-15/h1-7,12,14,17,19,26H,8-11,13H2 |
| InChIKey | HVYRIPAMKMYLJQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|