C21H25N3O7S — CID 90996203
N-hydroxy-N-[(1R)-2-[4-(4-methyl-2-nitrophenoxy)piperidin-1-yl]sulfonyl-1-phenylethyl]formamide (PubChem CID 90996203) has the molecular formula C21H25N3O7S and a molecular weight of 463.51 g/mol. Its IUPAC name is N-hydroxy-N-[(1R)-2-[4-(4-methyl-2-nitrophenoxy)piperidin-1-yl]sulfonyl-1-phenylethyl]formamide.
| Compound Name | N-hydroxy-N-[(1R)-2-[4-(4-methyl-2-nitrophenoxy)piperidin-1-yl]sulfonyl-1-phenylethyl]formamide |
|---|---|
| PubChem CID | 90996203 |
| Molecular Formula | C21H25N3O7S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-hydroxy-N-[(1R)-2-[4-(4-methyl-2-nitrophenoxy)piperidin-1-yl]sulfonyl-1-phenylethyl]formamide |
| SMILES | Cc1ccc(OC2CCN(S(=O)(=O)C[C@@H](c3ccccc3)N(O)C=O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25N3O7S/c1-16-7-8-21(19(13-16)24(27)28)31-18-9-11-22(12-10-18)32(29,30)14-20(23(26)15-25)17-5-3-2-4-6-17/h2-8,13,15,18,20,26H,9-12,14H2,1H3/t20-/m0/s1 |
| InChIKey | WUXVKZLKRDEBJF-FQEVSTJZSA-N |
| XLogP | 2.67 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|