C10H15BN2O4S2 — CID 58685945
CID 58685945 (PubChem CID 58685945) has the molecular formula C10H15BN2O4S2 and a molecular weight of 302.19 g/mol.
| Compound Name | CID 58685945 |
|---|---|
| PubChem CID | 58685945 |
| Molecular Formula | C10H15BN2O4S2 |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | — |
| SMILES | [B]CN(CCS(C)(=O)=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C10H15BN2O4S2/c1-18(14,15)7-6-13(8-11)9-2-4-10(5-3-9)19(12,16)17/h2-5H,6-8H2,1H3,(H2,12,16,17) |
| InChIKey | JQMFVDAMKMFTLC-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|