C19H21Cl2N5OS — CID 58688455
5-[6-(2,5-dichlorophenyl)-2-(2-methoxyethylamino)pyrimidin-4-yl]-N-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 58688455) has the molecular formula C19H21Cl2N5OS and a molecular weight of 438.38 g/mol. Its IUPAC name is 5-[6-(2,5-dichlorophenyl)-2-(2-methoxyethylamino)pyrimidin-4-yl]-N-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | 5-[6-(2,5-dichlorophenyl)-2-(2-methoxyethylamino)pyrimidin-4-yl]-N-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58688455 |
| Molecular Formula | C19H21Cl2N5OS |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 5-[6-(2,5-dichlorophenyl)-2-(2-methoxyethylamino)pyrimidin-4-yl]-N-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | COCCNc1nc(-c2cnc(NC(C)C)s2)cc(-c2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C19H21Cl2N5OS/c1-11(2)24-19-23-10-17(28-19)16-9-15(13-8-12(20)4-5-14(13)21)25-18(26-16)22-6-7-27-3/h4-5,8-11H,6-7H2,1-3H3,(H,23,24)(H,22,25,26) |
| InChIKey | LFRJMMZKEGYTPO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|